C16H23Cl2NO — CID 116762307
N-[(2,3-dichlorophenyl)-(1-ethoxycyclopentyl)methyl]ethanamine (PubChem CID 116762307) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)-(1-ethoxycyclopentyl)methyl]ethanamine.
| Compound Name | N-[(2,3-dichlorophenyl)-(1-ethoxycyclopentyl)methyl]ethanamine |
|---|---|
| PubChem CID | 116762307 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[(2,3-dichlorophenyl)-(1-ethoxycyclopentyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Cl)c1Cl)C1(OCC)CCCC1 |
| InChI | InChI=1S/C16H23Cl2NO/c1-3-19-15(12-8-7-9-13(17)14(12)18)16(20-4-2)10-5-6-11-16/h7-9,15,19H,3-6,10-11H2,1-2H3 |
| InChIKey | FRJGNMMJMNHJHR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |