C25H50O3Si — CID 11676258
[(1S,2Z)-2-(6,6-dimethoxyhexylidene)-4,4-dimethylcyclohexyl]oxy-tri(propan-2-yl)silane (PubChem CID 11676258) has the molecular formula C25H50O3Si and a molecular weight of 426.76 g/mol. Its IUPAC name is [(1S,2Z)-2-(6,6-dimethoxyhexylidene)-4,4-dimethylcyclohexyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,2Z)-2-(6,6-dimethoxyhexylidene)-4,4-dimethylcyclohexyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11676258 |
| Molecular Formula | C25H50O3Si |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | [(1S,2Z)-2-(6,6-dimethoxyhexylidene)-4,4-dimethylcyclohexyl]oxy-tri(propan-2-yl)silane |
| SMILES | COC(CCCC/C=C1/CC(C)(C)CC[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C25H50O3Si/c1-19(2)29(20(3)4,21(5)6)28-23-16-17-25(7,8)18-22(23)14-12-11-13-15-24(26-9)27-10/h14,19-21,23-24H,11-13,15-18H2,1-10H3/b22-14-/t23-/m0/s1 |
| InChIKey | JLWLCOFKVOEIBQ-SINAZASISA-N |
| XLogP | 7.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|