C17H23NOS — CID 116762819
1-(1-benzothiophen-7-yl)-1-(1-methoxycyclohexyl)-N-methylmethanamine (PubChem CID 116762819) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-1-(1-methoxycyclohexyl)-N-methylmethanamine.
| Compound Name | 1-(1-benzothiophen-7-yl)-1-(1-methoxycyclohexyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116762819 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-1-(1-methoxycyclohexyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc2ccsc12)C1(OC)CCCCC1 |
| InChI | InChI=1S/C17H23NOS/c1-18-16(17(19-2)10-4-3-5-11-17)14-8-6-7-13-9-12-20-15(13)14/h6-9,12,16,18H,3-5,10-11H2,1-2H3 |
| InChIKey | RZLSDLOXZDSJLK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |