C17H19ClN2O2S2 — CID 1167631
4-chloro-N-[(1S,2R)-2-pyridin-2-ylsulfanylcyclohexyl]benzenesulfonamide (PubChem CID 1167631) has the molecular formula C17H19ClN2O2S2 and a molecular weight of 382.94 g/mol. Its IUPAC name is 4-chloro-N-[(1S,2R)-2-pyridin-2-ylsulfanylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(1S,2R)-2-pyridin-2-ylsulfanylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1167631 |
| Molecular Formula | C17H19ClN2O2S2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-chloro-N-[(1S,2R)-2-pyridin-2-ylsulfanylcyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@H]1Sc1ccccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O2S2/c18-13-8-10-14(11-9-13)24(21,22)20-15-5-1-2-6-16(15)23-17-7-3-4-12-19-17/h3-4,7-12,15-16,20H,1-2,5-6H2/t15-,16+/m0/s1 |
| InChIKey | FOGHAIRVAITWCW-JKSUJKDBSA-N |
| XLogP | 4.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |