C16H27NOS — CID 116763483
N-[(1-methoxycyclohexyl)-(5-methylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 116763483) has the molecular formula C16H27NOS and a molecular weight of 281.46 g/mol. Its IUPAC name is N-[(1-methoxycyclohexyl)-(5-methylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(1-methoxycyclohexyl)-(5-methylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 116763483 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-[(1-methoxycyclohexyl)-(5-methylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C)s1)C1(OC)CCCCC1 |
| InChI | InChI=1S/C16H27NOS/c1-4-12-17-15(14-9-8-13(2)19-14)16(18-3)10-6-5-7-11-16/h8-9,15,17H,4-7,10-12H2,1-3H3 |
| InChIKey | WXNQVWPHWSYCQC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |