C20H22BrFN2O3 — CID 11676472
butyl 4-(2-bromo-4-fluorophenyl)-5-cyano-2-(methoxymethyl)-6-methyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 11676472) has the molecular formula C20H22BrFN2O3 and a molecular weight of 437.31 g/mol. Its IUPAC name is butyl 4-(2-bromo-4-fluorophenyl)-5-cyano-2-(methoxymethyl)-6-methyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | butyl 4-(2-bromo-4-fluorophenyl)-5-cyano-2-(methoxymethyl)-6-methyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 11676472 |
| Molecular Formula | C20H22BrFN2O3 |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | butyl 4-(2-bromo-4-fluorophenyl)-5-cyano-2-(methoxymethyl)-6-methyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(COC)NC(C)=C(C#N)C1c1ccc(F)cc1Br |
| InChI | InChI=1S/C20H22BrFN2O3/c1-4-5-8-27-20(25)19-17(11-26-3)24-12(2)15(10-23)18(19)14-7-6-13(22)9-16(14)21/h6-7,9,18,24H,4-5,8,11H2,1-3H3 |
| InChIKey | BSBLMHPOUMWXES-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|