C23H27N5O4 — CID 11676479
N-(cyclopropylmethyl)-2-[[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide (PubChem CID 11676479) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-[[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 11676479 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]amino]acetamide |
| SMILES | C[C@H]1O[C@@H](n2cc(-c3ccccc3)c3c(NCC(=O)NCC4CC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H27N5O4/c1-13-19(30)20(31)23(32-13)28-11-16(15-5-3-2-4-6-15)18-21(26-12-27-22(18)28)25-10-17(29)24-9-14-7-8-14/h2-6,11-14,19-20,23,30-31H,7-10H2,1H3,(H,24,29)(H,25,26,27)/t13-,19-,20-,23-/m1/s1 |
| InChIKey | RUFQNSVJZGBIQU-HYYMDVBZSA-N |
| XLogP | 1.68 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |