About 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile
2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile (PubChem CID 11676572) has the molecular formula C24H29N2O+
and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile.
Molecular Properties
| Compound Name | 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile |
| PubChem CID | 11676572 |
| Molecular Formula | C24H29N2O+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)C12CC[N+](CCCO)(CC1)CC2 |
| InChI | InChI=1S/C24H29N2O/c25-20-24(21-8-3-1-4-9-21,22-10-5-2-6-11-22)23-12-16-26(17-13-23,18-14-23)15-7-19-27/h1-6,8-11,27H,7,12-19H2/q+1 |
| InChIKey | DFYSCYLRSSWPNP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile?
The IUPAC name of 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile (CID 11676572) is 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile.
What is the SMILES notation for 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile?
The canonical SMILES for 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile is N#CC(c1ccccc1)(c1ccccc1)C12CC[N+](CCCO)(CC1)CC2.
What is the InChIKey of 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile?
The InChIKey is DFYSCYLRSSWPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N2O/c25-20-24(21-8-3-1-4-9-21,22-10-5-2-6-11-22)23-12-16-26(17-13-23,18-14-23)15-7-19-27/h1-6,8-11,27H,7,12-19H2/q+1.
What are the key properties of 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile?
2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile has a molecular weight of 361.51 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-hydroxypropyl)-1-azoniabicyclo[2.2.2]octan-4-yl]-2,2-diphenylacetonitrile is sourced from PubChem (CID 11676572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).