C15H27N3O2 — CID 116765818
N-[(4-ethoxyoxan-4-yl)-(1-ethylimidazol-2-yl)methyl]ethanamine (PubChem CID 116765818) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(4-ethoxyoxan-4-yl)-(1-ethylimidazol-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-ethoxyoxan-4-yl)-(1-ethylimidazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 116765818 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-[(4-ethoxyoxan-4-yl)-(1-ethylimidazol-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1nccn1CC)C1(OCC)CCOCC1 |
| InChI | InChI=1S/C15H27N3O2/c1-4-16-13(14-17-9-10-18(14)5-2)15(20-6-3)7-11-19-12-8-15/h9-10,13,16H,4-8,11-12H2,1-3H3 |
| InChIKey | RKGFESILYOVDCH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |