C24H32O4S2 — CID 11676740
(2S)-2-[(2R)-2-(1-ethoxyethoxy)-3-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]propyl]-2,3-dihydropyran-6-one (PubChem CID 11676740) has the molecular formula C24H32O4S2 and a molecular weight of 448.65 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-(1-ethoxyethoxy)-3-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]propyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(2R)-2-(1-ethoxyethoxy)-3-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]propyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11676740 |
| Molecular Formula | C24H32O4S2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (2S)-2-[(2R)-2-(1-ethoxyethoxy)-3-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]propyl]-2,3-dihydropyran-6-one |
| SMILES | CCOC(C)O[C@H](C[C@@H]1CC=CC(=O)O1)CC1(/C=C/c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C24H32O4S2/c1-3-26-19(2)27-22(17-21-11-7-12-23(25)28-21)18-24(29-15-8-16-30-24)14-13-20-9-5-4-6-10-20/h4-7,9-10,12-14,19,21-22H,3,8,11,15-18H2,1-2H3/b14-13+/t19?,21-,22+/m0/s1 |
| InChIKey | LOQATHKQXLVINH-GQKVNQKWSA-N |
| XLogP | 5.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|