C28H40N2OSi — CID 11676741
5'-[(E)-prop-1-enyl]-1'-prop-2-enyl-2'-[2-tri(propan-2-yl)silylethynyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 11676741) has the molecular formula C28H40N2OSi and a molecular weight of 448.73 g/mol. Its IUPAC name is 5'-[(E)-prop-1-enyl]-1'-prop-2-enyl-2'-[2-tri(propan-2-yl)silylethynyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 5'-[(E)-prop-1-enyl]-1'-prop-2-enyl-2'-[2-tri(propan-2-yl)silylethynyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 11676741 |
| Molecular Formula | C28H40N2OSi |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 5'-[(E)-prop-1-enyl]-1'-prop-2-enyl-2'-[2-tri(propan-2-yl)silylethynyl]spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | C=CCN1C(/C=C/C)CC2(C(=O)Nc3ccccc32)C1C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H40N2OSi/c1-9-13-23-19-28(24-14-11-12-15-25(24)29-27(28)31)26(30(23)17-10-2)16-18-32(20(3)4,21(5)6)22(7)8/h9-15,20-23,26H,2,17,19H2,1,3-8H3,(H,29,31)/b13-9+ |
| InChIKey | GXZJDMBHLCRHAL-UKTHLTGXSA-N |
| XLogP | 6.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|