C16H27NOS — CID 116768130
1-(1-ethoxy-3-methylcyclohexyl)-3-thiophen-3-ylpropan-1-amine (PubChem CID 116768130) has the molecular formula C16H27NOS and a molecular weight of 281.46 g/mol. Its IUPAC name is 1-(1-ethoxy-3-methylcyclohexyl)-3-thiophen-3-ylpropan-1-amine.
| Compound Name | 1-(1-ethoxy-3-methylcyclohexyl)-3-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 116768130 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-(1-ethoxy-3-methylcyclohexyl)-3-thiophen-3-ylpropan-1-amine |
| SMILES | CCOC1(C(N)CCc2ccsc2)CCCC(C)C1 |
| InChI | InChI=1S/C16H27NOS/c1-3-18-16(9-4-5-13(2)11-16)15(17)7-6-14-8-10-19-12-14/h8,10,12-13,15H,3-7,9,11,17H2,1-2H3 |
| InChIKey | NLTWCCBCDLMQIQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |