C16H33NO3S — CID 116768268
1-(1-ethoxy-3-methylcyclohexyl)-4-ethylsulfonyl-N-methylbutan-1-amine (PubChem CID 116768268) has the molecular formula C16H33NO3S and a molecular weight of 319.51 g/mol. Its IUPAC name is 1-(1-ethoxy-3-methylcyclohexyl)-4-ethylsulfonyl-N-methylbutan-1-amine.
| Compound Name | 1-(1-ethoxy-3-methylcyclohexyl)-4-ethylsulfonyl-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 116768268 |
| Molecular Formula | C16H33NO3S |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | 1-(1-ethoxy-3-methylcyclohexyl)-4-ethylsulfonyl-N-methylbutan-1-amine |
| SMILES | CCOC1(C(CCCS(=O)(=O)CC)NC)CCCC(C)C1 |
| InChI | InChI=1S/C16H33NO3S/c1-5-20-16(11-7-9-14(3)13-16)15(17-4)10-8-12-21(18,19)6-2/h14-15,17H,5-13H2,1-4H3 |
| InChIKey | XJFOCZHVXJZOKP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |