C29H33N3O2 — CID 11676872
(2S)-2-amino-3-methyl-N-[6-oxo-7-(4-phenylbutyl)-7H-benzo[d][1]benzazepin-5-yl]butanamide (PubChem CID 11676872) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[6-oxo-7-(4-phenylbutyl)-7H-benzo[d][1]benzazepin-5-yl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[6-oxo-7-(4-phenylbutyl)-7H-benzo[d][1]benzazepin-5-yl]butanamide |
|---|---|
| PubChem CID | 11676872 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[6-oxo-7-(4-phenylbutyl)-7H-benzo[d][1]benzazepin-5-yl]butanamide |
| SMILES | CC(C)[C@H](N)C(=O)NN1C(=O)C(CCCCc2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H33N3O2/c1-20(2)27(30)28(33)31-32-26-19-11-10-17-24(26)22-15-8-9-16-23(22)25(29(32)34)18-7-6-14-21-12-4-3-5-13-21/h3-5,8-13,15-17,19-20,25,27H,6-7,14,18,30H2,1-2H3,(H,31,33)/t25?,27-/m0/s1 |
| InChIKey | UGYWFYRDYDKSKA-GPNIZQGCSA-N |
| XLogP | 5.21 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|