C9H16O4 — CID 116769100
2-ethoxy-2-(oxan-3-yl)acetic acid (PubChem CID 116769100) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-ethoxy-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-ethoxy-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 116769100 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-ethoxy-2-(oxan-3-yl)acetic acid |
| SMILES | CCOC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C9H16O4/c1-2-13-8(9(10)11)7-4-3-5-12-6-7/h7-8H,2-6H2,1H3,(H,10,11) |
| InChIKey | YLLNXBGQMAHOPL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |