2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid

C12H14O5 — CID 116769366

IUPAC2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid
SMILESCOC(C(=O)O)c1ccc2c(c1)OCCCO2
InChIInChI=1S/C12H14O5/c1-15-11(12(13)14)8-3-4-9-10(7-8)17-6-2-5-16-9/h3-4,7,11H,2,5-6H2,1H3,(H,13,14)
InChIKeyOHSPTEWHSIZJLH-UHFFFAOYSA-N
MW238.24 g/mol
LogP1.62
Rot. Bonds3

About 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid

2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid (PubChem CID 116769366) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid.

Molecular Properties

Compound Name2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid
PubChem CID116769366
Molecular FormulaC12H14O5
Molecular Weight238.24 g/mol
Exact Mass238.08
IUPAC Name2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid
SMILESCOC(C(=O)O)c1ccc2c(c1)OCCCO2
InChIInChI=1S/C12H14O5/c1-15-11(12(13)14)8-3-4-9-10(7-8)17-6-2-5-16-9/h3-4,7,11H,2,5-6H2,1H3,(H,13,14)
InChIKeyOHSPTEWHSIZJLH-UHFFFAOYSA-N
XLogP1.62
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 51.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid?
The IUPAC name of 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid (CID 116769366) is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid.
What is the SMILES notation for 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid?
The canonical SMILES for 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid is COC(C(=O)O)c1ccc2c(c1)OCCCO2.
What is the InChIKey of 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid?
The InChIKey is OHSPTEWHSIZJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-15-11(12(13)14)8-3-4-9-10(7-8)17-6-2-5-16-9/h3-4,7,11H,2,5-6H2,1H3,(H,13,14).
What are the key properties of 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid?
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid has a molecular weight of 238.24 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methoxyacetic acid is sourced from PubChem (CID 116769366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).