C15H9F13O2 — CID 11677106
2,3,5-trimethyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 11677106) has the molecular formula C15H9F13O2 and a molecular weight of 468.21 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11677106 |
| Molecular Formula | C15H9F13O2 |
| Molecular Weight | 468.21 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 2,3,5-trimethyl-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C15H9F13O2/c1-4-5(2)9(30)7(6(3)8(4)29)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h1-3H3 |
| InChIKey | QQAZYIDOEQZNGF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|