C27H29ClN2O2S — CID 11677372
N-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide (PubChem CID 11677372) has the molecular formula C27H29ClN2O2S and a molecular weight of 481.06 g/mol. Its IUPAC name is N-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 11677372 |
| Molecular Formula | C27H29ClN2O2S |
| Molecular Weight | 481.06 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H29ClN2O2S/c1-2-3-4-7-20-10-16-23(17-11-20)33(31,32)29-19-18-25-24-8-5-6-9-26(24)30-27(25)21-12-14-22(28)15-13-21/h5-6,8-17,29-30H,2-4,7,18-19H2,1H3 |
| InChIKey | JVKZLEZXLNTXPZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.06 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|