C30H27NO5 — CID 11677380
diethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate (PubChem CID 11677380) has the molecular formula C30H27NO5 and a molecular weight of 481.55 g/mol. Its IUPAC name is diethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate.
| Compound Name | diethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11677380 |
| Molecular Formula | C30H27NO5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | diethyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2(O/C1=N\c1c(C)cccc1C)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C30H27NO5/c1-5-34-28(32)24-25(29(33)35-6-2)30(36-27(24)31-26-18(3)12-11-13-19(26)4)22-16-9-7-14-20(22)21-15-8-10-17-23(21)30/h7-17H,5-6H2,1-4H3/b31-27- |
| InChIKey | JVYNEWYUXATQRA-QVTSOHHYSA-N |
| XLogP | 5.71 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|