C13H18N2O5 — CID 116775167
ethyl 2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 116775167) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is ethyl 2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116775167 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethyl 2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C2(OC)CCOCC2)[nH]c1=O |
| InChI | InChI=1S/C13H18N2O5/c1-3-20-11(17)9-8-14-12(15-10(9)16)13(18-2)4-6-19-7-5-13/h8H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | MKZVBRBIKZHULM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |