C26H30F3N3O3 — CID 11677549
1-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propan-2-one (PubChem CID 11677549) has the molecular formula C26H30F3N3O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is 1-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propan-2-one.
| Compound Name | 1-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propan-2-one |
|---|---|
| PubChem CID | 11677549 |
| Molecular Formula | C26H30F3N3O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 1-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propan-2-one |
| SMILES | CC(=O)COc1ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C26H30F3N3O3/c1-16(33)15-35-23-9-8-21(17(2)18(23)3)22-6-4-5-20-14-31(11-12-32(20)22)25(34)19-7-10-24(30-13-19)26(27,28)29/h7-10,13,20,22H,4-6,11-12,14-15H2,1-3H3/t20-,22+/m0/s1 |
| InChIKey | WAWGZWCYPBLMLU-RBBKRZOGSA-N |
| XLogP | 4.74 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |