C35H54O — CID 11677578
(4aS,10aS)-6-[[(1R,4S,4aR,8aR)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene (PubChem CID 11677578) has the molecular formula C35H54O and a molecular weight of 490.82 g/mol. Its IUPAC name is (4aS,10aS)-6-[[(1R,4S,4aR,8aR)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene.
| Compound Name | (4aS,10aS)-6-[[(1R,4S,4aR,8aR)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene |
|---|---|
| PubChem CID | 11677578 |
| Molecular Formula | C35H54O |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 490.42 |
| IUPAC Name | (4aS,10aS)-6-[[(1R,4S,4aR,8aR)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]oxy]-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene |
| SMILES | CC1=C[C@@H]2[C@@H](CC1)[C@](C)(Oc1cc3c(cc1C(C)C)CC[C@H]1C(C)(C)CCC[C@]31C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C35H54O/c1-22(2)26-15-18-35(9,29-13-11-24(5)19-28(26)29)36-31-21-30-25(20-27(31)23(3)4)12-14-32-33(6,7)16-10-17-34(30,32)8/h19-23,26,28-29,32H,10-18H2,1-9H3/t26-,28-,29+,32-,34+,35+/m0/s1 |
| InChIKey | PUOUOSYFDPLSOP-TYEQMGJPSA-N |
| XLogP | 10.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|