C13H22BrN3O — CID 116776475
5-bromo-2-(3-ethoxypentan-3-yl)-N,6-dimethylpyrimidin-4-amine (PubChem CID 116776475) has the molecular formula C13H22BrN3O and a molecular weight of 316.24 g/mol. Its IUPAC name is 5-bromo-2-(3-ethoxypentan-3-yl)-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(3-ethoxypentan-3-yl)-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116776475 |
| Molecular Formula | C13H22BrN3O |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 5-bromo-2-(3-ethoxypentan-3-yl)-N,6-dimethylpyrimidin-4-amine |
| SMILES | CCOC(CC)(CC)c1nc(C)c(Br)c(NC)n1 |
| InChI | InChI=1S/C13H22BrN3O/c1-6-13(7-2,18-8-3)12-16-9(4)10(14)11(15-5)17-12/h6-8H2,1-5H3,(H,15,16,17) |
| InChIKey | VGRAWTNGJJIVCL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |