C16H26BrN3O — CID 116776509
5-bromo-2-[cyclohexyl(ethoxy)methyl]-N-ethyl-6-methylpyrimidin-4-amine (PubChem CID 116776509) has the molecular formula C16H26BrN3O and a molecular weight of 356.31 g/mol. Its IUPAC name is 5-bromo-2-[cyclohexyl(ethoxy)methyl]-N-ethyl-6-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-[cyclohexyl(ethoxy)methyl]-N-ethyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116776509 |
| Molecular Formula | C16H26BrN3O |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 5-bromo-2-[cyclohexyl(ethoxy)methyl]-N-ethyl-6-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(C(OCC)C2CCCCC2)nc(C)c1Br |
| InChI | InChI=1S/C16H26BrN3O/c1-4-18-15-13(17)11(3)19-16(20-15)14(21-5-2)12-9-7-6-8-10-12/h12,14H,4-10H2,1-3H3,(H,18,19,20) |
| InChIKey | WXXKENGQKJISCK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |