About 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine
2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 116777338) has the molecular formula C12H19N3OS
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| PubChem CID | 116777338 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | CCOC(C)(CC)c1nc(N)c2c(n1)CSC2 |
| InChI | InChI=1S/C12H19N3OS/c1-4-12(3,16-5-2)11-14-9-7-17-6-8(9)10(13)15-11/h4-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | BRCMZUJRLFXSPR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The IUPAC name of 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (CID 116777338) is 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine is CCOC(C)(CC)c1nc(N)c2c(n1)CSC2.
What is the InChIKey of 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
The InChIKey is BRCMZUJRLFXSPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3OS/c1-4-12(3,16-5-2)11-14-9-7-17-6-8(9)10(13)15-11/h4-7H2,1-3H3,(H2,13,14,15).
What are the key properties of 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine?
2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine has a molecular weight of 253.37 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxybutan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 116777338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).