C11H18N4O — CID 116777611
[2-(1-ethoxycyclopentyl)pyrimidin-4-yl]hydrazine (PubChem CID 116777611) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is [2-(1-ethoxycyclopentyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(1-ethoxycyclopentyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 116777611 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [2-(1-ethoxycyclopentyl)pyrimidin-4-yl]hydrazine |
| SMILES | CCOC1(c2nccc(NN)n2)CCCC1 |
| InChI | InChI=1S/C11H18N4O/c1-2-16-11(6-3-4-7-11)10-13-8-5-9(14-10)15-12/h5,8H,2-4,6-7,12H2,1H3,(H,13,14,15) |
| InChIKey | HGSKLROJTTWJEK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|