C17H25ClO2S — CID 116779701
2-(3-chlorophenyl)sulfanyl-1-(1-ethoxy-4-methylcyclohexyl)ethanol (PubChem CID 116779701) has the molecular formula C17H25ClO2S and a molecular weight of 328.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-1-(1-ethoxy-4-methylcyclohexyl)ethanol.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-1-(1-ethoxy-4-methylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 116779701 |
| Molecular Formula | C17H25ClO2S |
| Molecular Weight | 328.90 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-1-(1-ethoxy-4-methylcyclohexyl)ethanol |
| SMILES | CCOC1(C(O)CSc2cccc(Cl)c2)CCC(C)CC1 |
| InChI | InChI=1S/C17H25ClO2S/c1-3-20-17(9-7-13(2)8-10-17)16(19)12-21-15-6-4-5-14(18)11-15/h4-6,11,13,16,19H,3,7-10,12H2,1-2H3 |
| InChIKey | JAFTZPADLIEYPB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |