C12H24N2O2 — CID 116780118
4-ethoxy-N,N-diethyloxane-4-carboximidamide (PubChem CID 116780118) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-ethoxy-N,N-diethyloxane-4-carboximidamide.
| Compound Name | 4-ethoxy-N,N-diethyloxane-4-carboximidamide |
|---|---|
| PubChem CID | 116780118 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-ethoxy-N,N-diethyloxane-4-carboximidamide |
| SMILES | [H]/N=C(\N(CC)CC)C1(OCC)CCOCC1 |
| InChI | InChI=1S/C12H24N2O2/c1-4-14(5-2)11(13)12(16-6-3)7-9-15-10-8-12/h13H,4-10H2,1-3H3/b13-11- |
| InChIKey | KZOZGCNBWVBLSH-QBFSEMIESA-N |
| XLogP | 1.89 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|