C25H24F7NO3 — CID 11678016
(3S,5R)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxypyrrolidin-2-one (PubChem CID 11678016) has the molecular formula C25H24F7NO3 and a molecular weight of 519.46 g/mol. Its IUPAC name is (3S,5R)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxypyrrolidin-2-one.
| Compound Name | (3S,5R)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11678016 |
| Molecular Formula | C25H24F7NO3 |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (3S,5R)-5-[(1R,2R,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)cyclopentyl]-3-hydroxypyrrolidin-2-one |
| SMILES | C[C@@H](O[C@H]1CC[C@@H]([C@H]2C[C@H](O)C(=O)N2)[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F7NO3/c1-12(14-8-15(24(27,28)29)10-16(9-14)25(30,31)32)36-21-7-6-18(19-11-20(34)23(35)33-19)22(21)13-2-4-17(26)5-3-13/h2-5,8-10,12,18-22,34H,6-7,11H2,1H3,(H,33,35)/t12-,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | BDRVVHYVGXCUPM-LVZBLCKSSA-N |
| XLogP | 5.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |