C11H20N2O3 — CID 116780621
1-[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 116780621) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | 1-[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 116780621 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CCOC(CC)(CC)c1noc(C(C)O)n1 |
| InChI | InChI=1S/C11H20N2O3/c1-5-11(6-2,15-7-3)10-12-9(8(4)14)16-13-10/h8,14H,5-7H2,1-4H3 |
| InChIKey | QKCVHNVOXZVMFN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |