C16H29N3O2 — CID 116781437
2-[3-(1-ethoxycycloheptyl)-1,2,4-oxadiazol-5-yl]pentan-3-amine (PubChem CID 116781437) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[3-(1-ethoxycycloheptyl)-1,2,4-oxadiazol-5-yl]pentan-3-amine.
| Compound Name | 2-[3-(1-ethoxycycloheptyl)-1,2,4-oxadiazol-5-yl]pentan-3-amine |
|---|---|
| PubChem CID | 116781437 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-[3-(1-ethoxycycloheptyl)-1,2,4-oxadiazol-5-yl]pentan-3-amine |
| SMILES | CCOC1(c2noc(C(C)C(N)CC)n2)CCCCCC1 |
| InChI | InChI=1S/C16H29N3O2/c1-4-13(17)12(3)14-18-15(19-21-14)16(20-5-2)10-8-6-7-9-11-16/h12-13H,4-11,17H2,1-3H3 |
| InChIKey | UJSNDSAOHQMEPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |