C16H20N2O3 — CID 116781646
3-[3-(1-ethoxycyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol (PubChem CID 116781646) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[3-(1-ethoxycyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol.
| Compound Name | 3-[3-(1-ethoxycyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
|---|---|
| PubChem CID | 116781646 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[3-(1-ethoxycyclopentyl)-1,2,4-oxadiazol-5-yl]-2-methylphenol |
| SMILES | CCOC1(c2noc(-c3cccc(O)c3C)n2)CCCC1 |
| InChI | InChI=1S/C16H20N2O3/c1-3-20-16(9-4-5-10-16)15-17-14(21-18-15)12-7-6-8-13(19)11(12)2/h6-8,19H,3-5,9-10H2,1-2H3 |
| InChIKey | SIKYWCMUTQIZNH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |