C15H26N4O — CID 116781918
4-(1-ethoxy-4-methylcyclohexyl)-6-propyl-1,3,5-triazin-2-amine (PubChem CID 116781918) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-(1-ethoxy-4-methylcyclohexyl)-6-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1-ethoxy-4-methylcyclohexyl)-6-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 116781918 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 4-(1-ethoxy-4-methylcyclohexyl)-6-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCc1nc(N)nc(C2(OCC)CCC(C)CC2)n1 |
| InChI | InChI=1S/C15H26N4O/c1-4-6-12-17-13(19-14(16)18-12)15(20-5-2)9-7-11(3)8-10-15/h11H,4-10H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | IQHBEAKWNIOEDR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |