C15H27N3OS — CID 116782367
N-tert-butyl-3-(1-ethoxycycloheptyl)-1,2,4-thiadiazol-5-amine (PubChem CID 116782367) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-tert-butyl-3-(1-ethoxycycloheptyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-tert-butyl-3-(1-ethoxycycloheptyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 116782367 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-tert-butyl-3-(1-ethoxycycloheptyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCOC1(c2nsc(NC(C)(C)C)n2)CCCCCC1 |
| InChI | InChI=1S/C15H27N3OS/c1-5-19-15(10-8-6-7-9-11-15)12-16-13(20-18-12)17-14(2,3)4/h5-11H2,1-4H3,(H,16,17,18) |
| InChIKey | WXOIVEHTTVYJNF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |