C11H13N3O3 — CID 116782615
2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 116782615) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 116782615 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(4-methoxyoxan-4-yl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COC1(c2ncc(C#N)c(=O)[nH]2)CCOCC1 |
| InChI | InChI=1S/C11H13N3O3/c1-16-11(2-4-17-5-3-11)10-13-7-8(6-12)9(15)14-10/h7H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | ZXNGPOGNUVRFRK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |