C15H25NOS — CID 116782816
2-(1-ethoxy-4-methylcyclohexyl)-5-propan-2-yl-1,3-thiazole (PubChem CID 116782816) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 2-(1-ethoxy-4-methylcyclohexyl)-5-propan-2-yl-1,3-thiazole.
| Compound Name | 2-(1-ethoxy-4-methylcyclohexyl)-5-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 116782816 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-(1-ethoxy-4-methylcyclohexyl)-5-propan-2-yl-1,3-thiazole |
| SMILES | CCOC1(c2ncc(C(C)C)s2)CCC(C)CC1 |
| InChI | InChI=1S/C15H25NOS/c1-5-17-15(8-6-12(4)7-9-15)14-16-10-13(18-14)11(2)3/h10-12H,5-9H2,1-4H3 |
| InChIKey | PIJJNXXECZURAY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |