C27H29Cl2N5O3 — CID 11678300
4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(2-chloro-6-methylphenyl)piperazine-1-carboxamide (PubChem CID 11678300) has the molecular formula C27H29Cl2N5O3 and a molecular weight of 542.47 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(2-chloro-6-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(2-chloro-6-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11678300 |
| Molecular Formula | C27H29Cl2N5O3 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 4-[4-[(5-chloro-2-ethoxyphenyl)carbamoylamino]phenyl]-N-(2-chloro-6-methylphenyl)piperazine-1-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3c(C)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C27H29Cl2N5O3/c1-3-37-24-12-7-19(28)17-23(24)31-26(35)30-20-8-10-21(11-9-20)33-13-15-34(16-14-33)27(36)32-25-18(2)5-4-6-22(25)29/h4-12,17H,3,13-16H2,1-2H3,(H,32,36)(H2,30,31,35) |
| InChIKey | QNFXOVJEXWGSMA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|