C12H9BrN6O — CID 116784345
3-amino-N-(3-bromoquinolin-8-yl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 116784345) has the molecular formula C12H9BrN6O and a molecular weight of 333.15 g/mol. Its IUPAC name is 3-amino-N-(3-bromoquinolin-8-yl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(3-bromoquinolin-8-yl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 116784345 |
| Molecular Formula | C12H9BrN6O |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 3-amino-N-(3-bromoquinolin-8-yl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)Nc2cccc3cc(Br)cnc23)n1 |
| InChI | InChI=1S/C12H9BrN6O/c13-7-4-6-2-1-3-8(9(6)15-5-7)16-11(20)10-17-12(14)19-18-10/h1-5H,(H,16,20)(H3,14,17,18,19) |
| InChIKey | SPMYWGNJCRJSQW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |