C27H41ClN2O6 — CID 11678518
[1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-pyrrolidin-1-ylethyl] N-(4-chlorophenyl)carbamate (PubChem CID 11678518) has the molecular formula C27H41ClN2O6 and a molecular weight of 525.09 g/mol. Its IUPAC name is [1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-pyrrolidin-1-ylethyl] N-(4-chlorophenyl)carbamate.
| Compound Name | [1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-pyrrolidin-1-ylethyl] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 11678518 |
| Molecular Formula | C27H41ClN2O6 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | [1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-pyrrolidin-1-ylethyl] N-(4-chlorophenyl)carbamate |
| SMILES | CCCCCCCO[C@H]1O[C@H](C(CN2CCCC2)OC(=O)Nc2ccc(Cl)cc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C27H41ClN2O6/c1-4-5-6-7-10-17-32-25-24-23(35-27(2,3)36-24)22(34-25)21(18-30-15-8-9-16-30)33-26(31)29-20-13-11-19(28)12-14-20/h11-14,21-25H,4-10,15-18H2,1-3H3,(H,29,31)/t21?,22-,23+,24+,25+/m1/s1 |
| InChIKey | OPTKMNARZQFLMT-MGRZVDMVSA-N |
| XLogP | 5.58 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|