C16H14BrN3S — CID 116785345
7-(3-bromoquinolin-8-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 116785345) has the molecular formula C16H14BrN3S and a molecular weight of 360.28 g/mol. Its IUPAC name is 7-(3-bromoquinolin-8-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | 7-(3-bromoquinolin-8-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 116785345 |
| Molecular Formula | C16H14BrN3S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 7-(3-bromoquinolin-8-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(s1)C(c1cccc3cc(Br)cnc13)CCC2 |
| InChI | InChI=1S/C16H14BrN3S/c17-10-7-9-3-1-4-11(14(9)19-8-10)12-5-2-6-13-15(12)21-16(18)20-13/h1,3-4,7-8,12H,2,5-6H2,(H2,18,20) |
| InChIKey | YTKCKLBIPJWLOY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |