C26H16F6O4S2 — CID 11678602
1,2,4-triphenyl-3,5-bis(trifluoromethylsulfonyl)benzene (PubChem CID 11678602) has the molecular formula C26H16F6O4S2 and a molecular weight of 570.53 g/mol. Its IUPAC name is 1,2,4-triphenyl-3,5-bis(trifluoromethylsulfonyl)benzene.
| Compound Name | 1,2,4-triphenyl-3,5-bis(trifluoromethylsulfonyl)benzene |
|---|---|
| PubChem CID | 11678602 |
| Molecular Formula | C26H16F6O4S2 |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | 1,2,4-triphenyl-3,5-bis(trifluoromethylsulfonyl)benzene |
| SMILES | O=S(=O)(c1cc(-c2ccccc2)c(-c2ccccc2)c(S(=O)(=O)C(F)(F)F)c1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H16F6O4S2/c27-25(28,29)37(33,34)21-16-20(17-10-4-1-5-11-17)22(18-12-6-2-7-13-18)24(38(35,36)26(30,31)32)23(21)19-14-8-3-9-15-19/h1-16H |
| InChIKey | ZCXVPFTXJSUNSW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |