C12H14N4O3S2 — CID 116786253
2-(2-aminophenyl)sulfanyl-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide (PubChem CID 116786253) has the molecular formula C12H14N4O3S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(2-aminophenyl)sulfanyl-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide.
| Compound Name | 2-(2-aminophenyl)sulfanyl-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 116786253 |
| Molecular Formula | C12H14N4O3S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(2-aminophenyl)sulfanyl-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide |
| SMILES | Nc1ccccc1SCCS(=O)(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H14N4O3S2/c13-9-3-1-2-4-10(9)20-7-8-21(18,19)16-11-5-6-12(17)15-14-11/h1-6H,7-8,13H2,(H,14,16)(H,15,17) |
| InChIKey | YLLOZHSPWFTUOO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|