C14H12N4O2 — CID 116787521
5-(4-hydroxybut-1-ynyl)-N-pyridazin-3-ylpyridine-2-carboxamide (PubChem CID 116787521) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 5-(4-hydroxybut-1-ynyl)-N-pyridazin-3-ylpyridine-2-carboxamide.
| Compound Name | 5-(4-hydroxybut-1-ynyl)-N-pyridazin-3-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 116787521 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-(4-hydroxybut-1-ynyl)-N-pyridazin-3-ylpyridine-2-carboxamide |
| SMILES | O=C(Nc1cccnn1)c1ccc(C#CCCO)cn1 |
| InChI | InChI=1S/C14H12N4O2/c19-9-2-1-4-11-6-7-12(15-10-11)14(20)17-13-5-3-8-16-18-13/h3,5-8,10,19H,2,9H2,(H,17,18,20) |
| InChIKey | RCJFJBXTBZUXQG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|