C12H11N5O4 — CID 116788082
3-(methylamino)-2-nitro-N-(6-oxo-1H-pyridazin-3-yl)benzamide (PubChem CID 116788082) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3-(methylamino)-2-nitro-N-(6-oxo-1H-pyridazin-3-yl)benzamide.
| Compound Name | 3-(methylamino)-2-nitro-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
|---|---|
| PubChem CID | 116788082 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-(methylamino)-2-nitro-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
| SMILES | CNc1cccc(C(=O)Nc2ccc(=O)[nH]n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N5O4/c1-13-8-4-2-3-7(11(8)17(20)21)12(19)14-9-5-6-10(18)16-15-9/h2-6,13H,1H3,(H,16,18)(H,14,15,19) |
| InChIKey | RSGVSPRCVCYMQK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|