About [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine
[2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine (PubChem CID 116789866) has the molecular formula C15H21F2NO
and a molecular weight of 269.33 g/mol. Its IUPAC name is [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine |
| PubChem CID | 116789866 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine |
| SMILES | NCC1CCCC1COCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C15H21F2NO/c16-15(17,14-7-2-1-3-8-14)11-19-10-13-6-4-5-12(13)9-18/h1-3,7-8,12-13H,4-6,9-11,18H2 |
| InChIKey | DLNQCRLUCHVLSA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine?
The IUPAC name of [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine (CID 116789866) is [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine.
What is the SMILES notation for [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine?
The canonical SMILES for [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine is NCC1CCCC1COCC(F)(F)c1ccccc1.
What is the InChIKey of [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine?
The InChIKey is DLNQCRLUCHVLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NO/c16-15(17,14-7-2-1-3-8-14)11-19-10-13-6-4-5-12(13)9-18/h1-3,7-8,12-13H,4-6,9-11,18H2.
What are the key properties of [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine?
[2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine has a molecular weight of 269.33 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,2-difluoro-2-phenylethoxy)methyl]cyclopentyl]methanamine is sourced from PubChem (CID 116789866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).