About 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid
4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid (PubChem CID 116789972) has the molecular formula C14H17F2NO3
and a molecular weight of 285.29 g/mol. Its IUPAC name is 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid |
| PubChem CID | 116789972 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid |
| SMILES | CN(CC(F)(F)c1ccccc1)C1COCC1C(=O)O |
| InChI | InChI=1S/C14H17F2NO3/c1-17(12-8-20-7-11(12)13(18)19)9-14(15,16)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3,(H,18,19) |
| InChIKey | USMGTWPOKYXECD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid?
The IUPAC name of 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid (CID 116789972) is 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid.
What is the SMILES notation for 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid?
The canonical SMILES for 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid is CN(CC(F)(F)c1ccccc1)C1COCC1C(=O)O.
What is the InChIKey of 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid?
The InChIKey is USMGTWPOKYXECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-17(12-8-20-7-11(12)13(18)19)9-14(15,16)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3,(H,18,19).
What are the key properties of 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid?
4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid has a molecular weight of 285.29 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-difluoro-2-phenylethyl)-methylamino]oxolane-3-carboxylic acid is sourced from PubChem (CID 116789972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).