About 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride
1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride (PubChem CID 116790221) has the molecular formula C13H13ClF2N2O2S
and a molecular weight of 334.78 g/mol. Its IUPAC name is 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride |
| PubChem CID | 116790221 |
| Molecular Formula | C13H13ClF2N2O2S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride |
| SMILES | CCc1nc(S(=O)(=O)Cl)cn1CC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C13H13ClF2N2O2S/c1-2-11-17-12(21(14,19)20)8-18(11)9-13(15,16)10-6-4-3-5-7-10/h3-8H,2,9H2,1H3 |
| InChIKey | QPKSFWBWPJSZPP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride?
The IUPAC name of 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride (CID 116790221) is 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride.
What is the SMILES notation for 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride?
The canonical SMILES for 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride is CCc1nc(S(=O)(=O)Cl)cn1CC(F)(F)c1ccccc1.
What is the InChIKey of 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride?
The InChIKey is QPKSFWBWPJSZPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClF2N2O2S/c1-2-11-17-12(21(14,19)20)8-18(11)9-13(15,16)10-6-4-3-5-7-10/h3-8H,2,9H2,1H3.
What are the key properties of 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride?
1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride has a molecular weight of 334.78 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoro-2-phenylethyl)-2-ethylimidazole-4-sulfonyl chloride is sourced from PubChem (CID 116790221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).