About 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile
3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile (PubChem CID 116791053) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile.
Molecular Properties
| Compound Name | 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile |
| PubChem CID | 116791053 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile |
| SMILES | COc1ccc(C#CC#N)c(OC)c1OC |
| InChI | InChI=1S/C12H11NO3/c1-14-10-7-6-9(5-4-8-13)11(15-2)12(10)16-3/h6-7H,1-3H3 |
| InChIKey | NDYZGTXJCKZXQO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile?
The IUPAC name of 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile (CID 116791053) is 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile.
What is the SMILES notation for 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile?
The canonical SMILES for 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile is COc1ccc(C#CC#N)c(OC)c1OC.
What is the InChIKey of 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile?
The InChIKey is NDYZGTXJCKZXQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c1-14-10-7-6-9(5-4-8-13)11(15-2)12(10)16-3/h6-7H,1-3H3.
What are the key properties of 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile?
3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile has a molecular weight of 217.22 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3,4-trimethoxyphenyl)prop-2-ynenitrile is sourced from PubChem (CID 116791053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).