C14H22ClNO — CID 116791144
3-chloro-1-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]propan-1-one (PubChem CID 116791144) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 3-chloro-1-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]propan-1-one.
| Compound Name | 3-chloro-1-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 116791144 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-chloro-1-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]propan-1-one |
| SMILES | Cc1cc(C(=O)CCCl)c(C)n1CCC(C)C |
| InChI | InChI=1S/C14H22ClNO/c1-10(2)6-8-16-11(3)9-13(12(16)4)14(17)5-7-15/h9-10H,5-8H2,1-4H3 |
| InChIKey | GTKHYYTXQHALIG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|