C9H13FN2O2S — CID 116791384
3-amino-5-fluoro-N,N,4-trimethylbenzenesulfonamide (PubChem CID 116791384) has the molecular formula C9H13FN2O2S and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-amino-5-fluoro-N,N,4-trimethylbenzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-N,N,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 116791384 |
| Molecular Formula | C9H13FN2O2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-amino-5-fluoro-N,N,4-trimethylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)N(C)C)cc1F |
| InChI | InChI=1S/C9H13FN2O2S/c1-6-8(10)4-7(5-9(6)11)15(13,14)12(2)3/h4-5H,11H2,1-3H3 |
| InChIKey | IQANSIQSNRZVMH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|